![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| moso bamboo.pdf | 2010-04-07 15:06 | 568K | |
| Zhang(2004)JASA.pdf | 2012-02-09 13:31 | 545K | |
| Temporal and Spatial variability of annual water level.pdf | 2010-04-13 22:23 | 870K | |
| Species spatial distribution.pdf | 2010-04-13 22:10 | 2.2M | |
| Spatial and temporal dynamics of seeding population.pdf | 2010-04-13 22:24 | 433K | |
| SPP for boreal chronosequence.pdf | 2010-04-07 15:09 | 463K | |
| References for Spatial Point Patterns.rtf | 2012-04-03 14:17 | 61K | |
| Interpolation altorighm ranking.pdf | 2010-04-07 14:53 | 545K | |
| Groundwater and Nitrogen fluxes.pdf | 2010-04-13 23:14 | 918K | |
| Gneiting (2006) Simulation of large spatial dataset.pdf | 2014-02-11 13:49 | 2.0M | |
| Drug arrests.pdf | 2010-04-07 14:57 | 648K | |
| Beyesian wombing for SPP.pdf | 2010-04-07 15:11 | 2.6M | |
| Additional References.pdf | 2010-04-14 23:56 | 36K | |